C31H34N2O8 — CID 19224833
2-(2,4-dimethoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19224833) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is 2-(2,4-dimethoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(2,4-dimethoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224833 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 2-(2,4-dimethoxyphenyl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | COc1ccc(C2C(C(=O)Nc3ccccc3OC)C(=O)CC(C)(O)C2C(=O)Nc2ccccc2OC)c(OC)c1 |
| InChI | InChI=1S/C31H34N2O8/c1-31(37)17-22(34)27(29(35)32-20-10-6-8-12-23(20)39-3)26(19-15-14-18(38-2)16-25(19)41-5)28(31)30(36)33-21-11-7-9-13-24(21)40-4/h6-16,26-28,37H,17H2,1-5H3,(H,32,35)(H,33,36) |
| InChIKey | IFDVEJTZUYJKMI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|