C28H32N4O6 — CID 100810849
(1S,2S,3S,4S)-2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 100810849) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is (1S,2S,3S,4S)-2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | (1S,2S,3S,4S)-2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 100810849 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (1S,2S,3S,4S)-2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@@H](C(=O)Nc2ccccc2OC)[C@@H]1c1cnn(C)c1C |
| InChI | InChI=1S/C28H32N4O6/c1-16-17(15-29-32(16)3)23-24(26(34)30-18-10-6-8-12-21(18)37-4)20(33)14-28(2,36)25(23)27(35)31-19-11-7-9-13-22(19)38-5/h6-13,15,23-25,36H,14H2,1-5H3,(H,30,34)(H,31,35)/t23-,24-,25-,28+/m1/s1 |
| InChIKey | SVTVASNUNNYOPG-NXNJFABFSA-N |
| XLogP | 3.06 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|