C27H27BrN2O7 — CID 19224837
2-(5-bromofuran-2-yl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19224837) has the molecular formula C27H27BrN2O7 and a molecular weight of 571.42 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(5-bromofuran-2-yl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224837 |
| Molecular Formula | C27H27BrN2O7 |
| Molecular Weight | 571.42 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-4-hydroxy-1-N,3-N-bis(2-methoxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2OC)C1c1ccc(Br)o1 |
| InChI | InChI=1S/C27H27BrN2O7/c1-27(34)14-17(31)22(25(32)29-15-8-4-6-10-18(15)35-2)23(20-12-13-21(28)37-20)24(27)26(33)30-16-9-5-7-11-19(16)36-3/h4-13,22-24,34H,14H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | PNKRNOBZTWZEJP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|