C31H33N3O6 — CID 19224942
1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19224942) has the molecular formula C31H33N3O6 and a molecular weight of 543.62 g/mol. Its IUPAC name is 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19224942 |
| Molecular Formula | C31H33N3O6 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 1-N,3-N-bis(2,4-dimethylphenyl)-4-hydroxy-4-methyl-2-(4-nitrophenyl)-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2C(=O)CC(C)(O)C(C(=O)Nc3ccc(C)cc3C)C2c2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C31H33N3O6/c1-17-6-12-23(19(3)14-17)32-29(36)27-25(35)16-31(5,38)28(26(27)21-8-10-22(11-9-21)34(39)40)30(37)33-24-13-7-18(2)15-20(24)4/h6-15,26-28,38H,16H2,1-5H3,(H,32,36)(H,33,37) |
| InChIKey | AVGYFSCQMANWHE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|