C36H43BrN2O6 — CID 19233642
2-(3-bromo-4-butoxy-5-methoxyphenyl)-1-N,3-N-bis(2,5-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233642) has the molecular formula C36H43BrN2O6 and a molecular weight of 679.65 g/mol. Its IUPAC name is 2-(3-bromo-4-butoxy-5-methoxyphenyl)-1-N,3-N-bis(2,5-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(3-bromo-4-butoxy-5-methoxyphenyl)-1-N,3-N-bis(2,5-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233642 |
| Molecular Formula | C36H43BrN2O6 |
| Molecular Weight | 679.65 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | 2-(3-bromo-4-butoxy-5-methoxyphenyl)-1-N,3-N-bis(2,5-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCCCOc1c(Br)cc(C2C(C(=O)Nc3cc(C)ccc3C)C(=O)CC(C)(O)C2C(=O)Nc2cc(C)ccc2C)cc1OC |
| InChI | InChI=1S/C36H43BrN2O6/c1-8-9-14-45-33-25(37)17-24(18-29(33)44-7)30-31(34(41)38-26-15-20(2)10-12-22(26)4)28(40)19-36(6,43)32(30)35(42)39-27-16-21(3)11-13-23(27)5/h10-13,15-18,30-32,43H,8-9,14,19H2,1-7H3,(H,38,41)(H,39,42) |
| InChIKey | CQCIXDOVDIRROB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.65 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|