C35H41BrN2O6 — CID 19233667
2-(3-bromo-4,5-diethoxyphenyl)-1-N,3-N-bis(2,5-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233667) has the molecular formula C35H41BrN2O6 and a molecular weight of 665.63 g/mol. Its IUPAC name is 2-(3-bromo-4,5-diethoxyphenyl)-1-N,3-N-bis(2,5-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(3-bromo-4,5-diethoxyphenyl)-1-N,3-N-bis(2,5-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233667 |
| Molecular Formula | C35H41BrN2O6 |
| Molecular Weight | 665.63 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | 2-(3-bromo-4,5-diethoxyphenyl)-1-N,3-N-bis(2,5-dimethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1cc(C2C(C(=O)Nc3cc(C)ccc3C)C(=O)CC(C)(O)C2C(=O)Nc2cc(C)ccc2C)cc(Br)c1OCC |
| InChI | InChI=1S/C35H41BrN2O6/c1-8-43-28-17-23(16-24(36)32(28)44-9-2)29-30(33(40)37-25-14-19(3)10-12-21(25)5)27(39)18-35(7,42)31(29)34(41)38-26-15-20(4)11-13-22(26)6/h10-17,29-31,42H,8-9,18H2,1-7H3,(H,37,40)(H,38,41) |
| InChIKey | WJNYUGUSYOFTML-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.63 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|