C31H33BrN2O4 — CID 19233423
2-(4-bromophenyl)-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233423) has the molecular formula C31H33BrN2O4 and a molecular weight of 577.52 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(4-bromophenyl)-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233423 |
| Molecular Formula | C31H33BrN2O4 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 2-(4-bromophenyl)-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2CC)C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H33BrN2O4/c1-4-19-10-6-8-12-23(19)33-29(36)27-25(35)18-31(3,38)28(26(27)21-14-16-22(32)17-15-21)30(37)34-24-13-9-7-11-20(24)5-2/h6-17,26-28,38H,4-5,18H2,1-3H3,(H,33,36)(H,34,37) |
| InChIKey | KVBXDASBWUPAMF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|