C38H38BrClN2O5 — CID 19233973
2-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233973) has the molecular formula C38H38BrClN2O5 and a molecular weight of 718.09 g/mol. Its IUPAC name is 2-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 2-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233973 |
| Molecular Formula | C38H38BrClN2O5 |
| Molecular Weight | 718.09 g/mol |
| Exact Mass | 716.17 |
| IUPAC Name | 2-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-1-N,3-N-bis(2-ethylphenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)C1C(=O)CC(C)(O)C(C(=O)Nc2ccccc2CC)C1c1cc(Br)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C38H38BrClN2O5/c1-4-23-12-7-10-16-29(23)41-36(44)34-31(43)21-38(3,46)35(37(45)42-30-17-11-8-13-24(30)5-2)33(34)27-20-26(39)18-19-32(27)47-22-25-14-6-9-15-28(25)40/h6-20,33-35,46H,4-5,21-22H2,1-3H3,(H,41,44)(H,42,45) |
| InChIKey | DBGIEHPNUVVESS-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.09 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|