C29H29BrN2O5 — CID 19225227
2-(5-bromo-2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide (PubChem CID 19225227) has the molecular formula C29H29BrN2O5 and a molecular weight of 565.46 g/mol. Its IUPAC name is 2-(5-bromo-2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide.
| Compound Name | 2-(5-bromo-2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19225227 |
| Molecular Formula | C29H29BrN2O5 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | 2-(5-bromo-2-ethoxyphenyl)-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1ccc(Br)cc1C1C(C(=O)Nc2ccccc2)C(=O)CC(C)(O)C1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H29BrN2O5/c1-3-37-23-15-14-18(30)16-21(23)24-25(27(34)31-19-10-6-4-7-11-19)22(33)17-29(2,36)26(24)28(35)32-20-12-8-5-9-13-20/h4-16,24-26,36H,3,17H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | NFCICOJGYIVEDZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|