C35H33ClN2O6 — CID 19225263
2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide (PubChem CID 19225263) has the molecular formula C35H33ClN2O6 and a molecular weight of 613.11 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide.
| Compound Name | 2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19225263 |
| Molecular Formula | C35H33ClN2O6 |
| Molecular Weight | 613.11 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenylcyclohexane-1,3-dicarboxamide |
| SMILES | COc1cc(C2C(C(=O)Nc3ccccc3)C(=O)CC(C)(O)C2C(=O)Nc2ccccc2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C35H33ClN2O6/c1-35(42)20-27(39)31(33(40)37-24-12-5-3-6-13-24)30(32(35)34(41)38-25-14-7-4-8-15-25)22-17-18-28(29(19-22)43-2)44-21-23-11-9-10-16-26(23)36/h3-19,30-32,42H,20-21H2,1-2H3,(H,37,40)(H,38,41) |
| InChIKey | QLVPPCOBSRMWRM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.11 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|