C38H48N2O6 — CID 19233800
1-N,3-N-bis(2,3-dimethylphenyl)-2-[4-ethoxy-3-(3-methylbutoxy)phenyl]-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide (PubChem CID 19233800) has the molecular formula C38H48N2O6 and a molecular weight of 628.81 g/mol. Its IUPAC name is 1-N,3-N-bis(2,3-dimethylphenyl)-2-[4-ethoxy-3-(3-methylbutoxy)phenyl]-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,3-dimethylphenyl)-2-[4-ethoxy-3-(3-methylbutoxy)phenyl]-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19233800 |
| Molecular Formula | C38H48N2O6 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | 1-N,3-N-bis(2,3-dimethylphenyl)-2-[4-ethoxy-3-(3-methylbutoxy)phenyl]-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxamide |
| SMILES | CCOc1ccc(C2C(C(=O)Nc3cccc(C)c3C)C(=O)CC(C)(O)C2C(=O)Nc2cccc(C)c2C)cc1OCCC(C)C |
| InChI | InChI=1S/C38H48N2O6/c1-9-45-31-17-16-27(20-32(31)46-19-18-22(2)3)33-34(36(42)39-28-14-10-12-23(4)25(28)6)30(41)21-38(8,44)35(33)37(43)40-29-15-11-13-24(5)26(29)7/h10-17,20,22,33-35,44H,9,18-19,21H2,1-8H3,(H,39,42)(H,40,43) |
| InChIKey | ONRUTXYIQCKGPU-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|