C30H32N2O4 — CID 124891226
(1S,2S,3R,4S)-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenyl-2-(4-propan-2-ylphenyl)cyclohexane-1,3-dicarboxamide (PubChem CID 124891226) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is (1S,2S,3R,4S)-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenyl-2-(4-propan-2-ylphenyl)cyclohexane-1,3-dicarboxamide.
| Compound Name | (1S,2S,3R,4S)-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenyl-2-(4-propan-2-ylphenyl)cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 124891226 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | (1S,2S,3R,4S)-4-hydroxy-4-methyl-6-oxo-1-N,3-N-diphenyl-2-(4-propan-2-ylphenyl)cyclohexane-1,3-dicarboxamide |
| SMILES | CC(C)c1ccc([C@@H]2[C@H](C(=O)Nc3ccccc3)C(=O)C[C@](C)(O)[C@@H]2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C30H32N2O4/c1-19(2)20-14-16-21(17-15-20)25-26(28(34)31-22-10-6-4-7-11-22)24(33)18-30(3,36)27(25)29(35)32-23-12-8-5-9-13-23/h4-17,19,25-27,36H,18H2,1-3H3,(H,31,34)(H,32,35)/t25-,26-,27+,30+/m1/s1 |
| InChIKey | LYJYZVIBXGVETA-KWWFCQITSA-N |
| XLogP | 5.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|