C23H30O8 — CID 4527695
dipropan-2-yl 4-hydroxy-2-(4-methoxycarbonylphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 4527695) has the molecular formula C23H30O8 and a molecular weight of 434.49 g/mol. Its IUPAC name is dipropan-2-yl 4-hydroxy-2-(4-methoxycarbonylphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | dipropan-2-yl 4-hydroxy-2-(4-methoxycarbonylphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4527695 |
| Molecular Formula | C23H30O8 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | dipropan-2-yl 4-hydroxy-2-(4-methoxycarbonylphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)c1ccc(C2C(C(=O)OC(C)C)C(=O)CC(C)(O)C2C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C23H30O8/c1-12(2)30-21(26)18-16(24)11-23(5,28)19(22(27)31-13(3)4)17(18)14-7-9-15(10-8-14)20(25)29-6/h7-10,12-13,17-19,28H,11H2,1-6H3 |
| InChIKey | CZCYWGTVNNUEQB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|