C20H27NO6 — CID 1125645
dipropan-2-yl (1S,2S,3S,4S)-4-hydroxy-4-methyl-6-oxo-2-pyridin-3-ylcyclohexane-1,3-dicarboxylate (PubChem CID 1125645) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is dipropan-2-yl (1S,2S,3S,4S)-4-hydroxy-4-methyl-6-oxo-2-pyridin-3-ylcyclohexane-1,3-dicarboxylate.
| Compound Name | dipropan-2-yl (1S,2S,3S,4S)-4-hydroxy-4-methyl-6-oxo-2-pyridin-3-ylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 1125645 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | dipropan-2-yl (1S,2S,3S,4S)-4-hydroxy-4-methyl-6-oxo-2-pyridin-3-ylcyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1C(=O)C[C@](C)(O)[C@@H](C(=O)OC(C)C)[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C20H27NO6/c1-11(2)26-18(23)16-14(22)9-20(5,25)17(19(24)27-12(3)4)15(16)13-7-6-8-21-10-13/h6-8,10-12,15-17,25H,9H2,1-5H3/t15-,16-,17-,20+/m1/s1 |
| InChIKey | OYCVZZUSJGVKGK-VIPLHTEESA-N |
| XLogP | 2.02 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|