C25H34O8 — CID 3834685
ditert-butyl 4-hydroxy-2-(4-methoxycarbonylphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 3834685) has the molecular formula C25H34O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is ditert-butyl 4-hydroxy-2-(4-methoxycarbonylphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | ditert-butyl 4-hydroxy-2-(4-methoxycarbonylphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3834685 |
| Molecular Formula | C25H34O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | ditert-butyl 4-hydroxy-2-(4-methoxycarbonylphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | COC(=O)c1ccc(C2C(C(=O)OC(C)(C)C)C(=O)CC(C)(O)C2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H34O8/c1-23(2,3)32-21(28)18-16(26)13-25(7,30)19(22(29)33-24(4,5)6)17(18)14-9-11-15(12-10-14)20(27)31-8/h9-12,17-19,30H,13H2,1-8H3 |
| InChIKey | NWQZSXJTPDQDFV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|