C27H34N2O7S — CID 26433328
diethyl (1S,2S,3R,4S,6Z)-4-hydroxy-4-methyl-2-(4-methylphenyl)-6-[(4-methylphenyl)sulfonylhydrazinylidene]cyclohexane-1,3-dicarboxylate (PubChem CID 26433328) has the molecular formula C27H34N2O7S and a molecular weight of 530.64 g/mol. Its IUPAC name is diethyl (1S,2S,3R,4S,6Z)-4-hydroxy-4-methyl-2-(4-methylphenyl)-6-[(4-methylphenyl)sulfonylhydrazinylidene]cyclohexane-1,3-dicarboxylate.
| Compound Name | diethyl (1S,2S,3R,4S,6Z)-4-hydroxy-4-methyl-2-(4-methylphenyl)-6-[(4-methylphenyl)sulfonylhydrazinylidene]cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 26433328 |
| Molecular Formula | C27H34N2O7S |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | diethyl (1S,2S,3R,4S,6Z)-4-hydroxy-4-methyl-2-(4-methylphenyl)-6-[(4-methylphenyl)sulfonylhydrazinylidene]cyclohexane-1,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1/C(=N\NS(=O)(=O)c2ccc(C)cc2)C[C@](C)(O)[C@H](C(=O)OCC)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C27H34N2O7S/c1-6-35-25(30)23-21(28-29-37(33,34)20-14-10-18(4)11-15-20)16-27(5,32)24(26(31)36-7-2)22(23)19-12-8-17(3)9-13-19/h8-15,22-24,29,32H,6-7,16H2,1-5H3/b28-21-/t22-,23+,24-,27-/m0/s1 |
| InChIKey | MMSXINWXYSMOQB-HRHXUPESSA-N |
| XLogP | 3.23 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|