C30H40N2O7S — CID 98081159
ditert-butyl (1S,2R,3R,4R,6Z)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylcyclohexane-1,3-dicarboxylate (PubChem CID 98081159) has the molecular formula C30H40N2O7S and a molecular weight of 572.72 g/mol. Its IUPAC name is ditert-butyl (1S,2R,3R,4R,6Z)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylcyclohexane-1,3-dicarboxylate.
| Compound Name | ditert-butyl (1S,2R,3R,4R,6Z)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylcyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 98081159 |
| Molecular Formula | C30H40N2O7S |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | ditert-butyl (1S,2R,3R,4R,6Z)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-phenylcyclohexane-1,3-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2/C[C@@](C)(O)[C@H](C(=O)OC(C)(C)C)[C@H](c3ccccc3)[C@@H]2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H40N2O7S/c1-19-14-16-21(17-15-19)40(36,37)32-31-22-18-30(8,35)25(27(34)39-29(5,6)7)23(20-12-10-9-11-13-20)24(22)26(33)38-28(2,3)4/h9-17,23-25,32,35H,18H2,1-8H3/b31-22-/t23-,24-,25+,30-/m1/s1 |
| InChIKey | YDQFEAJMPQODHM-WEBKNVSCSA-N |
| XLogP | 4.48 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|