C30H39N3O9S — CID 100810218
ditert-butyl (1S,2S,3R,4S,6Z)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-(3-nitrophenyl)cyclohexane-1,3-dicarboxylate (PubChem CID 100810218) has the molecular formula C30H39N3O9S and a molecular weight of 617.72 g/mol. Its IUPAC name is ditert-butyl (1S,2S,3R,4S,6Z)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-(3-nitrophenyl)cyclohexane-1,3-dicarboxylate.
| Compound Name | ditert-butyl (1S,2S,3R,4S,6Z)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-(3-nitrophenyl)cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 100810218 |
| Molecular Formula | C30H39N3O9S |
| Molecular Weight | 617.72 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | ditert-butyl (1S,2S,3R,4S,6Z)-4-hydroxy-4-methyl-6-[(4-methylphenyl)sulfonylhydrazinylidene]-2-(3-nitrophenyl)cyclohexane-1,3-dicarboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2/C[C@](C)(O)[C@H](C(=O)OC(C)(C)C)[C@@H](c3cccc([N+](=O)[O-])c3)[C@@H]2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H39N3O9S/c1-18-12-14-21(15-13-18)43(39,40)32-31-22-17-30(8,36)25(27(35)42-29(5,6)7)23(24(22)26(34)41-28(2,3)4)19-10-9-11-20(16-19)33(37)38/h9-16,23-25,32,36H,17H2,1-8H3/b31-22-/t23-,24+,25-,30-/m0/s1 |
| InChIKey | DOXZXPPIXLMYEL-ISFVAONFSA-N |
| XLogP | 4.39 |
| TPSA | 174.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.72 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|