C18H23N3O4 — CID 57202134
tert-butyl 6-ethyl-3-methyl-5-(3-nitrophenyl)-4,5-dihydropyridazine-4-carboxylate (PubChem CID 57202134) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is tert-butyl 6-ethyl-3-methyl-5-(3-nitrophenyl)-4,5-dihydropyridazine-4-carboxylate.
| Compound Name | tert-butyl 6-ethyl-3-methyl-5-(3-nitrophenyl)-4,5-dihydropyridazine-4-carboxylate |
|---|---|
| PubChem CID | 57202134 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | tert-butyl 6-ethyl-3-methyl-5-(3-nitrophenyl)-4,5-dihydropyridazine-4-carboxylate |
| SMILES | CCC1=NN=C(C)C(C(=O)OC(C)(C)C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H23N3O4/c1-6-14-16(12-8-7-9-13(10-12)21(23)24)15(11(2)19-20-14)17(22)25-18(3,4)5/h7-10,15-16H,6H2,1-5H3 |
| InChIKey | YYYZJHJJTONLAV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|