C17H21N3O5 — CID 57190050
2-methoxyethyl 6-ethyl-3-methyl-5-(3-nitrophenyl)-4,5-dihydropyridazine-4-carboxylate (PubChem CID 57190050) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-methoxyethyl 6-ethyl-3-methyl-5-(3-nitrophenyl)-4,5-dihydropyridazine-4-carboxylate.
| Compound Name | 2-methoxyethyl 6-ethyl-3-methyl-5-(3-nitrophenyl)-4,5-dihydropyridazine-4-carboxylate |
|---|---|
| PubChem CID | 57190050 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-methoxyethyl 6-ethyl-3-methyl-5-(3-nitrophenyl)-4,5-dihydropyridazine-4-carboxylate |
| SMILES | CCC1=NN=C(C)C(C(=O)OCCOC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21N3O5/c1-4-14-16(12-6-5-7-13(10-12)20(22)23)15(11(2)18-19-14)17(21)25-9-8-24-3/h5-7,10,15-16H,4,8-9H2,1-3H3 |
| InChIKey | AOMURLVXNWNOKT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|