C24H30N2O7S — CID 134954132
tert-butyl (3R,4S,5R)-3-hydroxy-3-methyl-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)piperidine-4-carboxylate (PubChem CID 134954132) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is tert-butyl (3R,4S,5R)-3-hydroxy-3-methyl-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)piperidine-4-carboxylate.
| Compound Name | tert-butyl (3R,4S,5R)-3-hydroxy-3-methyl-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 134954132 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | tert-butyl (3R,4S,5R)-3-hydroxy-3-methyl-1-(4-methylphenyl)sulfonyl-5-(4-nitrophenyl)piperidine-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](c3ccc([N+](=O)[O-])cc3)[C@H](C(=O)OC(C)(C)C)[C@@](C)(O)C2)cc1 |
| InChI | InChI=1S/C24H30N2O7S/c1-16-6-12-19(13-7-16)34(31,32)25-14-20(17-8-10-18(11-9-17)26(29)30)21(24(5,28)15-25)22(27)33-23(2,3)4/h6-13,20-21,28H,14-15H2,1-5H3/t20-,21+,24-/m0/s1 |
| InChIKey | IXLWARDLTYYYRP-IMSXRSKXSA-N |
| XLogP | 3.40 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|