C27H29N3O10S2 — CID 53254308
tert-butyl N-[(1S,2S,5R,8R)-4-(4-methylphenyl)sulfonyl-6-oxo-11-oxa-4-azatricyclo[6.2.1.01,5]undec-9-en-2-yl]-N-(4-nitrophenyl)sulfonylcarbamate (PubChem CID 53254308) has the molecular formula C27H29N3O10S2 and a molecular weight of 619.67 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,5R,8R)-4-(4-methylphenyl)sulfonyl-6-oxo-11-oxa-4-azatricyclo[6.2.1.01,5]undec-9-en-2-yl]-N-(4-nitrophenyl)sulfonylcarbamate.
| Compound Name | tert-butyl N-[(1S,2S,5R,8R)-4-(4-methylphenyl)sulfonyl-6-oxo-11-oxa-4-azatricyclo[6.2.1.01,5]undec-9-en-2-yl]-N-(4-nitrophenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 53254308 |
| Molecular Formula | C27H29N3O10S2 |
| Molecular Weight | 619.67 g/mol |
| Exact Mass | 619.13 |
| IUPAC Name | tert-butyl N-[(1S,2S,5R,8R)-4-(4-methylphenyl)sulfonyl-6-oxo-11-oxa-4-azatricyclo[6.2.1.01,5]undec-9-en-2-yl]-N-(4-nitrophenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](N(C(=O)OC(C)(C)C)S(=O)(=O)c3ccc([N+](=O)[O-])cc3)[C@@]34C=C[C@@H](CC(=O)[C@H]23)O4)cc1 |
| InChI | InChI=1S/C27H29N3O10S2/c1-17-5-9-20(10-6-17)41(35,36)28-16-23(27-14-13-19(39-27)15-22(31)24(27)28)29(25(32)40-26(2,3)4)42(37,38)21-11-7-18(8-12-21)30(33)34/h5-14,19,23-24H,15-16H2,1-4H3/t19-,23-,24-,27-/m0/s1 |
| InChIKey | QPUMXVPBQXQMHN-LBDWYMBGSA-N |
| XLogP | 2.94 |
| TPSA | 170.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|