C19H24BrN3O7S — CID 122668381
tert-butyl 4-bromo-3-[(4-nitrophenyl)sulfonyl-prop-2-enoxyamino]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 122668381) has the molecular formula C19H24BrN3O7S and a molecular weight of 518.39 g/mol. Its IUPAC name is tert-butyl 4-bromo-3-[(4-nitrophenyl)sulfonyl-prop-2-enoxyamino]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-bromo-3-[(4-nitrophenyl)sulfonyl-prop-2-enoxyamino]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 122668381 |
| Molecular Formula | C19H24BrN3O7S |
| Molecular Weight | 518.39 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | tert-butyl 4-bromo-3-[(4-nitrophenyl)sulfonyl-prop-2-enoxyamino]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=CCON(C1CN(C(=O)OC(C)(C)C)CC=C1Br)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H24BrN3O7S/c1-5-12-29-23(31(27,28)15-8-6-14(7-9-15)22(25)26)17-13-21(11-10-16(17)20)18(24)30-19(2,3)4/h5-10,17H,1,11-13H2,2-4H3 |
| InChIKey | GKPSPTDFGGYJOJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|