C23H31N3O6S — CID 11005303
tert-butyl N-[(1R,2S)-2-[[(4-nitrophenyl)sulfonyl-prop-2-enylamino]methyl]cyclopent-3-en-1-yl]-N-prop-2-enylcarbamate (PubChem CID 11005303) has the molecular formula C23H31N3O6S and a molecular weight of 477.58 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S)-2-[[(4-nitrophenyl)sulfonyl-prop-2-enylamino]methyl]cyclopent-3-en-1-yl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[(1R,2S)-2-[[(4-nitrophenyl)sulfonyl-prop-2-enylamino]methyl]cyclopent-3-en-1-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 11005303 |
| Molecular Formula | C23H31N3O6S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | tert-butyl N-[(1R,2S)-2-[[(4-nitrophenyl)sulfonyl-prop-2-enylamino]methyl]cyclopent-3-en-1-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)[C@@H]1CC=C[C@H]1CN(CC=C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H31N3O6S/c1-6-15-24(33(30,31)20-13-11-19(12-14-20)26(28)29)17-18-9-8-10-21(18)25(16-7-2)22(27)32-23(3,4)5/h6-9,11-14,18,21H,1-2,10,15-17H2,3-5H3/t18-,21+/m0/s1 |
| InChIKey | DDBGVDSEBJDSHE-GHTZIAJQSA-N |
| XLogP | 4.14 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|