C25H39N3O5SSi — CID 11027739
N-[(1S,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(prop-2-enylamino)cyclohept-2-en-1-yl]-4-nitro-N-prop-2-enylbenzenesulfonamide (PubChem CID 11027739) has the molecular formula C25H39N3O5SSi and a molecular weight of 521.76 g/mol. Its IUPAC name is N-[(1S,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(prop-2-enylamino)cyclohept-2-en-1-yl]-4-nitro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-[(1S,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(prop-2-enylamino)cyclohept-2-en-1-yl]-4-nitro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 11027739 |
| Molecular Formula | C25H39N3O5SSi |
| Molecular Weight | 521.76 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | N-[(1S,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(prop-2-enylamino)cyclohept-2-en-1-yl]-4-nitro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN[C@@H]1C=C[C@@H](N(CC=C)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H39N3O5SSi/c1-8-16-26-20-10-11-22(19-23(18-20)33-35(6,7)25(3,4)5)27(17-9-2)34(31,32)24-14-12-21(13-15-24)28(29)30/h8-15,20,22-23,26H,1-2,16-19H2,3-7H3/t20-,22-,23-/m1/s1 |
| InChIKey | XGDYCTYBCQORDM-YMPZKCBVSA-N |
| XLogP | 5.02 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.76 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|