C15H17N3O6S — CID 10861503
N-cyclohex-2-en-1-yl-2,4-dinitro-N-prop-2-enylbenzenesulfonamide (PubChem CID 10861503) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-2,4-dinitro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-cyclohex-2-en-1-yl-2,4-dinitro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 10861503 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | N-cyclohex-2-en-1-yl-2,4-dinitro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(C1C=CCCC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N3O6S/c1-2-10-16(12-6-4-3-5-7-12)25(23,24)15-9-8-13(17(19)20)11-14(15)18(21)22/h2,4,6,8-9,11-12H,1,3,5,7,10H2 |
| InChIKey | LFUISRFOSKYZAS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|