C16H18N2O7S — CID 101084405
methyl [(1R,4S)-4-[(4-nitrophenyl)sulfonyl-prop-2-enylamino]cyclopent-2-en-1-yl] carbonate (PubChem CID 101084405) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is methyl [(1R,4S)-4-[(4-nitrophenyl)sulfonyl-prop-2-enylamino]cyclopent-2-en-1-yl] carbonate.
| Compound Name | methyl [(1R,4S)-4-[(4-nitrophenyl)sulfonyl-prop-2-enylamino]cyclopent-2-en-1-yl] carbonate |
|---|---|
| PubChem CID | 101084405 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | methyl [(1R,4S)-4-[(4-nitrophenyl)sulfonyl-prop-2-enylamino]cyclopent-2-en-1-yl] carbonate |
| SMILES | C=CCN([C@@H]1C=C[C@H](OC(=O)OC)C1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H18N2O7S/c1-3-10-17(13-4-7-14(11-13)25-16(19)24-2)26(22,23)15-8-5-12(6-9-15)18(20)21/h3-9,13-14H,1,10-11H2,2H3/t13-,14+/m1/s1 |
| InChIKey | JAUMCFPJKYHSJL-KGLIPLIRSA-N |
| XLogP | 2.25 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|