C29H38N4O10S2 — CID 101084408
N-[(1R,4S)-4-[but-3-enyl-(4-nitrophenyl)sulfonylamino]cyclopent-2-en-1-yl]-N-(4,4-diethoxybutyl)-4-nitrobenzenesulfonamide (PubChem CID 101084408) has the molecular formula C29H38N4O10S2 and a molecular weight of 666.78 g/mol. Its IUPAC name is N-[(1R,4S)-4-[but-3-enyl-(4-nitrophenyl)sulfonylamino]cyclopent-2-en-1-yl]-N-(4,4-diethoxybutyl)-4-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,4S)-4-[but-3-enyl-(4-nitrophenyl)sulfonylamino]cyclopent-2-en-1-yl]-N-(4,4-diethoxybutyl)-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 101084408 |
| Molecular Formula | C29H38N4O10S2 |
| Molecular Weight | 666.78 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | N-[(1R,4S)-4-[but-3-enyl-(4-nitrophenyl)sulfonylamino]cyclopent-2-en-1-yl]-N-(4,4-diethoxybutyl)-4-nitrobenzenesulfonamide |
| SMILES | C=CCCN([C@@H]1C=C[C@H](N(CCCC(OCC)OCC)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H38N4O10S2/c1-4-7-20-30(44(38,39)27-16-12-23(13-17-27)32(34)35)25-10-11-26(22-25)31(21-8-9-29(42-5-2)43-6-3)45(40,41)28-18-14-24(15-19-28)33(36)37/h4,10-19,25-26,29H,1,5-9,20-22H2,2-3H3/t25-,26+/m1/s1 |
| InChIKey | AALZGCNVFQMLQP-FTJBHMTQSA-N |
| XLogP | 4.64 |
| TPSA | 179.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.78 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|