About but-3-enyl 4-nitrobenzenesulfonate
but-3-enyl 4-nitrobenzenesulfonate (PubChem CID 11334370) has the molecular formula C10H11NO5S
and a molecular weight of 257.27 g/mol. Its IUPAC name is but-3-enyl 4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | but-3-enyl 4-nitrobenzenesulfonate |
| PubChem CID | 11334370 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | but-3-enyl 4-nitrobenzenesulfonate |
| SMILES | C=CCCOS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H11NO5S/c1-2-3-8-16-17(14,15)10-6-4-9(5-7-10)11(12)13/h2,4-7H,1,3,8H2 |
| InChIKey | DTZGFFLYJFMNME-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl 4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl 4-nitrobenzenesulfonate?
The IUPAC name of but-3-enyl 4-nitrobenzenesulfonate (CID 11334370) is but-3-enyl 4-nitrobenzenesulfonate.
What is the SMILES notation for but-3-enyl 4-nitrobenzenesulfonate?
The canonical SMILES for but-3-enyl 4-nitrobenzenesulfonate is C=CCCOS(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of but-3-enyl 4-nitrobenzenesulfonate?
The InChIKey is DTZGFFLYJFMNME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5S/c1-2-3-8-16-17(14,15)10-6-4-9(5-7-10)11(12)13/h2,4-7H,1,3,8H2.
What are the key properties of but-3-enyl 4-nitrobenzenesulfonate?
but-3-enyl 4-nitrobenzenesulfonate has a molecular weight of 257.27 g/mol, XLogP of 1.88, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl 4-nitrobenzenesulfonate is sourced from PubChem (CID 11334370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).