About 3-thiocyanatopropyl 4-nitrobenzenesulfonate
3-thiocyanatopropyl 4-nitrobenzenesulfonate (PubChem CID 102233867) has the molecular formula C10H10N2O5S2
and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-thiocyanatopropyl 4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | 3-thiocyanatopropyl 4-nitrobenzenesulfonate |
| PubChem CID | 102233867 |
| Molecular Formula | C10H10N2O5S2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 3-thiocyanatopropyl 4-nitrobenzenesulfonate |
| SMILES | N#CSCCCOS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H10N2O5S2/c11-8-18-7-1-6-17-19(15,16)10-4-2-9(3-5-10)12(13)14/h2-5H,1,6-7H2 |
| InChIKey | JARQWOGRQSHZJY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 3-thiocyanatopropyl 4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiocyanatopropyl 4-nitrobenzenesulfonate?
The IUPAC name of 3-thiocyanatopropyl 4-nitrobenzenesulfonate (CID 102233867) is 3-thiocyanatopropyl 4-nitrobenzenesulfonate.
What is the SMILES notation for 3-thiocyanatopropyl 4-nitrobenzenesulfonate?
The canonical SMILES for 3-thiocyanatopropyl 4-nitrobenzenesulfonate is N#CSCCCOS(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 3-thiocyanatopropyl 4-nitrobenzenesulfonate?
The InChIKey is JARQWOGRQSHZJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O5S2/c11-8-18-7-1-6-17-19(15,16)10-4-2-9(3-5-10)12(13)14/h2-5H,1,6-7H2.
What are the key properties of 3-thiocyanatopropyl 4-nitrobenzenesulfonate?
3-thiocyanatopropyl 4-nitrobenzenesulfonate has a molecular weight of 302.33 g/mol, XLogP of 1.90, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiocyanatopropyl 4-nitrobenzenesulfonate is sourced from PubChem (CID 102233867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).