About 3-(4-nitrophenyl)butyl thiocyanate
3-(4-nitrophenyl)butyl thiocyanate (PubChem CID 112717782) has the molecular formula C11H12N2O2S
and a molecular weight of 236.30 g/mol. Its IUPAC name is 3-(4-nitrophenyl)butyl thiocyanate.
Molecular Properties
| Compound Name | 3-(4-nitrophenyl)butyl thiocyanate |
| PubChem CID | 112717782 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-(4-nitrophenyl)butyl thiocyanate |
| SMILES | CC(CCSC#N)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H12N2O2S/c1-9(6-7-16-8-12)10-2-4-11(5-3-10)13(14)15/h2-5,9H,6-7H2,1H3 |
| InChIKey | AUGQHFBREJSRPR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-nitrophenyl)butyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-nitrophenyl)butyl thiocyanate?
The IUPAC name of 3-(4-nitrophenyl)butyl thiocyanate (CID 112717782) is 3-(4-nitrophenyl)butyl thiocyanate.
What is the SMILES notation for 3-(4-nitrophenyl)butyl thiocyanate?
The canonical SMILES for 3-(4-nitrophenyl)butyl thiocyanate is CC(CCSC#N)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 3-(4-nitrophenyl)butyl thiocyanate?
The InChIKey is AUGQHFBREJSRPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2S/c1-9(6-7-16-8-12)10-2-4-11(5-3-10)13(14)15/h2-5,9H,6-7H2,1H3.
What are the key properties of 3-(4-nitrophenyl)butyl thiocyanate?
3-(4-nitrophenyl)butyl thiocyanate has a molecular weight of 236.30 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-nitrophenyl)butyl thiocyanate is sourced from PubChem (CID 112717782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).