C15H21NO2S — CID 112717384
3-(3,4-diethoxyphenyl)butyl thiocyanate (PubChem CID 112717384) has the molecular formula C15H21NO2S and a molecular weight of 279.40 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)butyl thiocyanate.
| Compound Name | 3-(3,4-diethoxyphenyl)butyl thiocyanate |
|---|---|
| PubChem CID | 112717384 |
| Molecular Formula | C15H21NO2S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)butyl thiocyanate |
| SMILES | CCOc1ccc(C(C)CCSC#N)cc1OCC |
| InChI | InChI=1S/C15H21NO2S/c1-4-17-14-7-6-13(10-15(14)18-5-2)12(3)8-9-19-11-16/h6-7,10,12H,4-5,8-9H2,1-3H3 |
| InChIKey | REACYCBTYBOAAL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|