About 3-(4-phenoxyphenyl)butyl thiocyanate
3-(4-phenoxyphenyl)butyl thiocyanate (PubChem CID 112719261) has the molecular formula C17H17NOS
and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)butyl thiocyanate.
Molecular Properties
| Compound Name | 3-(4-phenoxyphenyl)butyl thiocyanate |
| PubChem CID | 112719261 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-(4-phenoxyphenyl)butyl thiocyanate |
| SMILES | CC(CCSC#N)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17NOS/c1-14(11-12-20-13-18)15-7-9-17(10-8-15)19-16-5-3-2-4-6-16/h2-10,14H,11-12H2,1H3 |
| InChIKey | QRTQTAIYAXMAAO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-phenoxyphenyl)butyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-phenoxyphenyl)butyl thiocyanate?
The IUPAC name of 3-(4-phenoxyphenyl)butyl thiocyanate (CID 112719261) is 3-(4-phenoxyphenyl)butyl thiocyanate.
What is the SMILES notation for 3-(4-phenoxyphenyl)butyl thiocyanate?
The canonical SMILES for 3-(4-phenoxyphenyl)butyl thiocyanate is CC(CCSC#N)c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 3-(4-phenoxyphenyl)butyl thiocyanate?
The InChIKey is QRTQTAIYAXMAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NOS/c1-14(11-12-20-13-18)15-7-9-17(10-8-15)19-16-5-3-2-4-6-16/h2-10,14H,11-12H2,1H3.
What are the key properties of 3-(4-phenoxyphenyl)butyl thiocyanate?
3-(4-phenoxyphenyl)butyl thiocyanate has a molecular weight of 283.40 g/mol, XLogP of 5.19, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-phenoxyphenyl)butyl thiocyanate is sourced from PubChem (CID 112719261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).