About 3-(4-fluorophenyl)butyl thiocyanate
3-(4-fluorophenyl)butyl thiocyanate (PubChem CID 112718460) has the molecular formula C11H12FNS
and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-(4-fluorophenyl)butyl thiocyanate.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)butyl thiocyanate |
| PubChem CID | 112718460 |
| Molecular Formula | C11H12FNS |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 3-(4-fluorophenyl)butyl thiocyanate |
| SMILES | CC(CCSC#N)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FNS/c1-9(6-7-14-8-13)10-2-4-11(12)5-3-10/h2-5,9H,6-7H2,1H3 |
| InChIKey | OLGUYHDXUSEUAT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)butyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)butyl thiocyanate?
The IUPAC name of 3-(4-fluorophenyl)butyl thiocyanate (CID 112718460) is 3-(4-fluorophenyl)butyl thiocyanate.
What is the SMILES notation for 3-(4-fluorophenyl)butyl thiocyanate?
The canonical SMILES for 3-(4-fluorophenyl)butyl thiocyanate is CC(CCSC#N)c1ccc(F)cc1.
What is the InChIKey of 3-(4-fluorophenyl)butyl thiocyanate?
The InChIKey is OLGUYHDXUSEUAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FNS/c1-9(6-7-14-8-13)10-2-4-11(12)5-3-10/h2-5,9H,6-7H2,1H3.
What are the key properties of 3-(4-fluorophenyl)butyl thiocyanate?
3-(4-fluorophenyl)butyl thiocyanate has a molecular weight of 209.29 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)butyl thiocyanate is sourced from PubChem (CID 112718460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).