C22H36N4O12S — CID 138731853
2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-nitrobenzenesulfonate (PubChem CID 138731853) has the molecular formula C22H36N4O12S and a molecular weight of 580.61 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-nitrobenzenesulfonate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 138731853 |
| Molecular Formula | C22H36N4O12S |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-nitrobenzenesulfonate |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H36N4O12S/c23-25-24-5-6-31-7-8-32-9-10-33-11-12-34-13-14-35-15-16-36-17-18-37-19-20-38-39(29,30)22-3-1-21(2-4-22)26(27)28/h1-4H,5-20H2 |
| InChIKey | BYAJPGBNBBKTMS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 199.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|