C33H46N10O15S — CID 158294345
3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-nitropyridine;2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate;2-nitropyridin-3-ol (PubChem CID 158294345) has the molecular formula C33H46N10O15S and a molecular weight of 854.85 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-nitropyridine;2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate;2-nitropyridin-3-ol.
| Compound Name | 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-nitropyridine;2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate;2-nitropyridin-3-ol |
|---|---|
| PubChem CID | 158294345 |
| Molecular Formula | C33H46N10O15S |
| Molecular Weight | 854.85 g/mol |
| Exact Mass | 854.29 |
| IUPAC Name | 3-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-2-nitropyridine;2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate;2-nitropyridin-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCN=[N+]=[N-])cc1.O=[N+]([O-])c1ncccc1O.[N-]=[N+]=NCCOCCOCCOCCOc1cccnc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N3O6S.C13H19N5O6.C5H4N2O3/c1-14-2-4-15(5-3-14)25(19,20)24-13-12-23-11-10-22-9-8-21-7-6-17-18-16;14-17-16-4-5-21-6-7-22-8-9-23-10-11-24-12-2-1-3-15-13(12)18(19)20;8-4-2-1-3-6-5(4)7(9)10/h2-5H,6-13H2,1H3;1-3H,4-11H2;1-3,8H |
| InChIKey | GLSNBSRQXMRHRU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 337.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|