C43H58N2O18S2 — CID 158548706
4-nitrophenol;2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate;2-[2-(2-propoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 158548706) has the molecular formula C43H58N2O18S2 and a molecular weight of 955.07 g/mol. Its IUPAC name is 4-nitrophenol;2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate;2-[2-(2-propoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 4-nitrophenol;2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate;2-[2-(2-propoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 158548706 |
| Molecular Formula | C43H58N2O18S2 |
| Molecular Weight | 955.07 g/mol |
| Exact Mass | 954.31 |
| IUPAC Name | 4-nitrophenol;2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate;2-[2-(2-propoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CCCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1.Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOc2ccc([N+](=O)[O-])cc2)cc1.O=[N+]([O-])c1ccc(O)cc1 |
| InChI | InChI=1S/C21H27NO9S.C16H26O6S.C6H5NO3/c1-18-2-8-21(9-3-18)32(25,26)31-17-15-29-13-11-27-10-12-28-14-16-30-20-6-4-19(5-7-20)22(23)24;1-3-8-19-9-10-20-11-12-21-13-14-22-23(17,18)16-6-4-15(2)5-7-16;8-6-3-1-5(2-4-6)7(9)10/h2-9H,10-17H2,1H3;4-7H,3,8-14H2,1-2H3;1-4,8H |
| InChIKey | HPLHFTPPJXIRJF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 257.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.07 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|