C28H42N6O12 — CID 161056035
1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-4-nitrobenzene;2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethanamine (PubChem CID 161056035) has the molecular formula C28H42N6O12 and a molecular weight of 654.67 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-4-nitrobenzene;2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-4-nitrobenzene;2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 161056035 |
| Molecular Formula | C28H42N6O12 |
| Molecular Weight | 654.67 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]-4-nitrobenzene;2-[2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethoxy]ethanamine |
| SMILES | NCCOCCOCCOCCOc1ccc([N+](=O)[O-])cc1.[N-]=[N+]=NCCOCCOCCOCCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N4O6.C14H22N2O6/c15-17-16-5-6-21-7-8-22-9-10-23-11-12-24-14-3-1-13(2-4-14)18(19)20;15-5-6-19-7-8-20-9-10-21-11-12-22-14-3-1-13(2-4-14)16(17)18/h1-4H,5-12H2;1-4H,5-12,15H2 |
| InChIKey | UCTLPRCBRJRMAZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 234.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|