C10H9F2NO5S — CID 86731320
[(1R)-2,2-difluorocyclopropyl]methyl 4-nitrobenzenesulfonate (PubChem CID 86731320) has the molecular formula C10H9F2NO5S and a molecular weight of 293.25 g/mol. Its IUPAC name is [(1R)-2,2-difluorocyclopropyl]methyl 4-nitrobenzenesulfonate.
| Compound Name | [(1R)-2,2-difluorocyclopropyl]methyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 86731320 |
| Molecular Formula | C10H9F2NO5S |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | [(1R)-2,2-difluorocyclopropyl]methyl 4-nitrobenzenesulfonate |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)OC[C@H]2CC2(F)F)cc1 |
| InChI | InChI=1S/C10H9F2NO5S/c11-10(12)5-7(10)6-18-19(16,17)9-3-1-8(2-4-9)13(14)15/h1-4,7H,5-6H2/t7-/m1/s1 |
| InChIKey | IVBFZUDVXUWEOW-SSDOTTSWSA-N |
| XLogP | 1.96 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|