C10H9F2NO3 — CID 67453576
1-[(2,2-difluorocyclopropyl)methoxy]-4-nitrobenzene (PubChem CID 67453576) has the molecular formula C10H9F2NO3 and a molecular weight of 229.18 g/mol. Its IUPAC name is 1-[(2,2-difluorocyclopropyl)methoxy]-4-nitrobenzene.
| Compound Name | 1-[(2,2-difluorocyclopropyl)methoxy]-4-nitrobenzene |
|---|---|
| PubChem CID | 67453576 |
| Molecular Formula | C10H9F2NO3 |
| Molecular Weight | 229.18 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 1-[(2,2-difluorocyclopropyl)methoxy]-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(OCC2CC2(F)F)cc1 |
| InChI | InChI=1S/C10H9F2NO3/c11-10(12)5-7(10)6-16-9-3-1-8(2-4-9)13(14)15/h1-4,7H,5-6H2 |
| InChIKey | GTMOHYPGJLKWRU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|