About 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene
1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene (PubChem CID 177362906) has the molecular formula C13H17NO5
and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene.
Molecular Properties
| Compound Name | 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene |
| PubChem CID | 177362906 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene |
| SMILES | COC1(OC)CC(COc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C13H17NO5/c1-17-13(18-2)7-10(8-13)9-19-12-5-3-11(4-6-12)14(15)16/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | SMODFPQEJSPNPI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene?
The IUPAC name of 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene (CID 177362906) is 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene.
What is the SMILES notation for 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene?
The canonical SMILES for 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene is COC1(OC)CC(COc2ccc([N+](=O)[O-])cc2)C1.
What is the InChIKey of 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene?
The InChIKey is SMODFPQEJSPNPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-17-13(18-2)7-10(8-13)9-19-12-5-3-11(4-6-12)14(15)16/h3-6,10H,7-9H2,1-2H3.
What are the key properties of 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene?
1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene has a molecular weight of 267.28 g/mol, XLogP of 2.37, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene is sourced from PubChem (CID 177362906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).