C13H17NO5 — CID 177362906
1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene (PubChem CID 177362906) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene.
| Compound Name | 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene |
|---|---|
| PubChem CID | 177362906 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-[(3,3-dimethoxycyclobutyl)methoxy]-4-nitrobenzene |
| SMILES | COC1(OC)CC(COc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C13H17NO5/c1-17-13(18-2)7-10(8-13)9-19-12-5-3-11(4-6-12)14(15)16/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | SMODFPQEJSPNPI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|