C13H15F2NO5S — CID 90427088
[dideuterio-(4,4-difluorocyclohexyl)methyl] 4-nitrobenzenesulfonate (PubChem CID 90427088) has the molecular formula C13H15F2NO5S and a molecular weight of 337.34 g/mol. Its IUPAC name is [dideuterio-(4,4-difluorocyclohexyl)methyl] 4-nitrobenzenesulfonate.
| Compound Name | [dideuterio-(4,4-difluorocyclohexyl)methyl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 90427088 |
| Molecular Formula | C13H15F2NO5S |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [dideuterio-(4,4-difluorocyclohexyl)methyl] 4-nitrobenzenesulfonate |
| SMILES | [2H]C([2H])(OS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H15F2NO5S/c14-13(15)7-5-10(6-8-13)9-21-22(19,20)12-3-1-11(2-4-12)16(17)18/h1-4,10H,5-9H2/i9D2 |
| InChIKey | ZPDQCIUMIPQQBZ-KNXIQCGSSA-N |
| XLogP | 3.13 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|