C10H13N3O3S — CID 168886753
1-cyclopropyl-N-[(4-nitrophenyl)sulfonimidoyl]methanamine (PubChem CID 168886753) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(4-nitrophenyl)sulfonimidoyl]methanamine.
| Compound Name | 1-cyclopropyl-N-[(4-nitrophenyl)sulfonimidoyl]methanamine |
|---|---|
| PubChem CID | 168886753 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-cyclopropyl-N-[(4-nitrophenyl)sulfonimidoyl]methanamine |
| SMILES | [H]N=S(=O)(NCC1CC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H13N3O3S/c11-17(16,12-7-8-1-2-8)10-5-3-9(4-6-10)13(14)15/h3-6,8H,1-2,7H2,(H2,11,12,16) |
| InChIKey | NZTBHLAFLQIHCC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|