C25H43N3O5S — CID 70020974
N-[[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]methyl]-4-nitrobenzenesulfonamide (PubChem CID 70020974) has the molecular formula C25H43N3O5S and a molecular weight of 497.70 g/mol. Its IUPAC name is N-[[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]methyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]methyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 70020974 |
| Molecular Formula | C25H43N3O5S |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | N-[[4-[6-[methyl(pentyl)amino]hexoxy]cyclohexyl]methyl]-4-nitrobenzenesulfonamide |
| SMILES | CCCCCN(C)CCCCCCOC1CCC(CNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C25H43N3O5S/c1-3-4-7-18-27(2)19-8-5-6-9-20-33-24-14-10-22(11-15-24)21-26-34(31,32)25-16-12-23(13-17-25)28(29)30/h12-13,16-17,22,24,26H,3-11,14-15,18-21H2,1-2H3 |
| InChIKey | MGOMFPFXAUCIDS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|