C20H31F3N2O3S — CID 91476936
N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 91476936) has the molecular formula C20H31F3N2O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91476936 |
| Molecular Formula | C20H31F3N2O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C)CCCCOC1CCC(CNS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H31F3N2O3S/c1-25(2)13-3-4-14-28-18-9-5-16(6-10-18)15-24-29(26,27)19-11-7-17(8-12-19)20(21,22)23/h7-8,11-12,16,18,24H,3-6,9-10,13-15H2,1-2H3 |
| InChIKey | JCIWJJJLNJFHAE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|