C21H33F3N2O2S — CID 90912734
N-[[4-[5-(ethylamino)pentyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 90912734) has the molecular formula C21H33F3N2O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is N-[[4-[5-(ethylamino)pentyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[4-[5-(ethylamino)pentyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90912734 |
| Molecular Formula | C21H33F3N2O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-[[4-[5-(ethylamino)pentyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCNCCCCCC1CCC(CNS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H33F3N2O2S/c1-2-25-15-5-3-4-6-17-7-9-18(10-8-17)16-26-29(27,28)20-13-11-19(12-14-20)21(22,23)24/h11-14,17-18,25-26H,2-10,15-16H2,1H3 |
| InChIKey | HDEDUZYOPNLSIP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|