C21H33F3N2O4S — CID 91597614
N-[[4-[3-[ethyl(2-hydroxyethyl)amino]propoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 91597614) has the molecular formula C21H33F3N2O4S and a molecular weight of 466.57 g/mol. Its IUPAC name is N-[[4-[3-[ethyl(2-hydroxyethyl)amino]propoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[4-[3-[ethyl(2-hydroxyethyl)amino]propoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 91597614 |
| Molecular Formula | C21H33F3N2O4S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-[[4-[3-[ethyl(2-hydroxyethyl)amino]propoxy]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN(CCO)CCCOC1CCC(CNS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H33F3N2O4S/c1-2-26(13-14-27)12-3-15-30-19-8-4-17(5-9-19)16-25-31(28,29)20-10-6-18(7-11-20)21(22,23)24/h6-7,10-11,17,19,25,27H,2-5,8-9,12-16H2,1H3 |
| InChIKey | REUFIQUXAWKXKD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|