C20H24F3N2O2S+ — CID 7451559
N-[(1-benzylpiperidin-1-ium-4-yl)methyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 7451559) has the molecular formula C20H24F3N2O2S+ and a molecular weight of 413.49 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-1-ium-4-yl)methyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1-benzylpiperidin-1-ium-4-yl)methyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7451559 |
| Molecular Formula | C20H24F3N2O2S+ |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[(1-benzylpiperidin-1-ium-4-yl)methyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC[NH+](Cc2ccccc2)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N2O2S/c21-20(22,23)18-6-8-19(9-7-18)28(26,27)24-14-16-10-12-25(13-11-16)15-17-4-2-1-3-5-17/h1-9,16,24H,10-15H2/p+1 |
| InChIKey | HZQQVIJWHWREGB-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |