C22H25F3N2O3S — CID 68813718
2-[4-(benzenesulfonamidomethyl)cyclohexyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 68813718) has the molecular formula C22H25F3N2O3S and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-[4-(benzenesulfonamidomethyl)cyclohexyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(benzenesulfonamidomethyl)cyclohexyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 68813718 |
| Molecular Formula | C22H25F3N2O3S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-[4-(benzenesulfonamidomethyl)cyclohexyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | NC(=O)C(c1ccc(C(F)(F)F)cc1)C1CCC(CNS(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25F3N2O3S/c23-22(24,25)18-12-10-17(11-13-18)20(21(26)28)16-8-6-15(7-9-16)14-27-31(29,30)19-4-2-1-3-5-19/h1-5,10-13,15-16,20,27H,6-9,14H2,(H2,26,28) |
| InChIKey | LPUZHFYBHASMKY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |