C21H23F3N4O4S — CID 11784998
N-[[4-[(pyridine-3-carbonylamino)carbamoyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 11784998) has the molecular formula C21H23F3N4O4S and a molecular weight of 484.50 g/mol. Its IUPAC name is N-[[4-[(pyridine-3-carbonylamino)carbamoyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[4-[(pyridine-3-carbonylamino)carbamoyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11784998 |
| Molecular Formula | C21H23F3N4O4S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-[[4-[(pyridine-3-carbonylamino)carbamoyl]cyclohexyl]methyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C(NNC(=O)C1CCC(CNS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1)c1cccnc1 |
| InChI | InChI=1S/C21H23F3N4O4S/c22-21(23,24)17-7-9-18(10-8-17)33(31,32)26-12-14-3-5-15(6-4-14)19(29)27-28-20(30)16-2-1-11-25-13-16/h1-2,7-11,13-15,26H,3-6,12H2,(H,27,29)(H,28,30) |
| InChIKey | FLZRRCIUNARBHW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|